Benzamide,4-[2-(1-ethenyl-5-nitro-1H-imidazol-2-yl)ethenyl]- structure
|
Common Name | Benzamide,4-[2-(1-ethenyl-5-nitro-1H-imidazol-2-yl)ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 41552-55-0 | Molecular Weight | 284.27000 | |
| Density | 1.32g/cm3 | Boiling Point | 593.8ºC at 760mmHg | |
| Molecular Formula | C14H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.9ºC | |
| Name | 4-[(E)-2-(1-ethenyl-5-nitroimidazol-2-yl)ethenyl]benzamide |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 593.8ºC at 760mmHg |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27000 |
| Flash Point | 312.9ºC |
| Exact Mass | 284.09100 |
| PSA | 106.73000 |
| LogP | 3.38460 |
| Index of Refraction | 1.637 |
| InChIKey | FPLSSHOFFOCPJG-VMPITWQZSA-N |
| SMILES | C=Cn1c([N+](=O)[O-])cnc1C=Cc1ccc(C(N)=O)cc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |