MAC173979
Modify Date: 2025-11-26 09:58:00
MAC173979 structure
|
Common Name | MAC173979 | ||
|---|---|---|---|---|
| CAS Number | 41501-64-8 | Molecular Weight | 246.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MAC173979MAC173979 is a novel time-dependent inhibitor of p-aminobenzoic acid biosynthesis with IC50 of 30 uM, represents the first PABA biosynthesis inhibitor with activity against Gram-negative bacteria.. |
| Name | 3,3-dichloro-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5Cl2NO3 |
|---|---|
| Molecular Weight | 246.04700 |
| Exact Mass | 244.96500 |
| PSA | 62.89000 |
| LogP | 3.61970 |
| InChIKey | OGORZYUCNNDKIC-UHFFFAOYSA-N |
| SMILES | O=C(C=C(Cl)Cl)c1cccc([N+](=O)[O-])c1 |
|
~%
MAC173979 CAS#:41501-64-8 |
| Literature: Atavin,A.S. et al. Zhurnal Organicheskoi Khimii, 1973 , vol. 9, p. 318 - 321,320 - 322 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Propen-1-one,3,3-dichloro-1-(3-nitrophenyl) |
| 2,2-Dichlorvinyl-m-nitrophenyl-keton |
| 2,2-dichlorovinyl 3-nitrophenyl ketone |