4-(4-nitrophenyl)-2-oxobut-3-enoic acid structure
|
Common Name | 4-(4-nitrophenyl)-2-oxobut-3-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 41462-01-5 | Molecular Weight | 221.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-nitrophenyl)-2-oxobut-3-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7NO5 |
|---|---|
| Molecular Weight | 221.16600 |
| Exact Mass | 221.03200 |
| PSA | 100.19000 |
| LogP | 1.78490 |
| InChIKey | JXNKXMXIAKGBOX-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
|
~%
4-(4-nitropheny... CAS#:41462-01-5 |
| Literature: Sen; Sen Journal of the Indian Chemical Society, 1934 , vol. 11, p. 417 Chem. Zentralbl., 1934 , vol. 105, # II p. 3374 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Butenoic acid,4-(4-nitrophenyl)-2-oxo |
| 4-(4-nitro-phenyl)-2-oxo-but-3-enoic acid |
| 4-Nitrobenzalbrenztraubensaeure |
| 4-(4-Nitro-phenyl)-2-oxo-but-3-ensaeure |