2-Benzothiazoleethanol,a-(trichloromethyl)- structure
|
Common Name | 2-Benzothiazoleethanol,a-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 4146-26-3 | Molecular Weight | 296.60100 | |
| Density | 1.58g/cm3 | Boiling Point | 392.4ºC at 760mmHg | |
| Molecular Formula | C10H8Cl3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.1ºC | |
| Name | 3-(1,3-benzothiazol-2-yl)-1,1,1-trichloropropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760mmHg |
| Molecular Formula | C10H8Cl3NOS |
| Molecular Weight | 296.60100 |
| Flash Point | 191.1ºC |
| Exact Mass | 294.93900 |
| PSA | 61.36000 |
| LogP | 3.56990 |
| Index of Refraction | 1.678 |
| InChIKey | ZWEVYWZFCYKBJY-UHFFFAOYSA-N |
| SMILES | OC(Cc1nc2ccccc2s1)C(Cl)(Cl)Cl |
|
~%
2-Benzothiazole... CAS#:4146-26-3 |
| Literature: Baumgarten,H.E. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 1539 - 1546 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-Benzothiazol-2-yl-1,1,1-trichlor-propan-2-ol |
| 2-benzothiazoleethanol,|A-(trichloromethyl) |
| 3-benzothiazol-2-yl-1,1,1-trichloro-propan-2-ol |