N-(3-amino-4,6-difluoro-2-nitro-phenyl)acetamide
Modify Date: 2025-10-21 17:47:09
N-(3-amino-4,6-difluoro-2-nitro-phenyl)acetamide structure
|
Common Name | N-(3-amino-4,6-difluoro-2-nitro-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 4140-68-5 | Molecular Weight | 231.15600 | |
| Density | 1.593g/cm3 | Boiling Point | 417.5ºC at 760 mmHg | |
| Molecular Formula | C8H7F2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.3ºC | |
| Name | N-(3-amino-4,6-difluoro-2-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760 mmHg |
| Molecular Formula | C8H7F2N3O3 |
| Molecular Weight | 231.15600 |
| Flash Point | 206.3ºC |
| Exact Mass | 231.04600 |
| PSA | 100.94000 |
| LogP | 2.59100 |
| Index of Refraction | 1.625 |
| InChIKey | ZTZUHQLFAKGCBK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(F)cc(F)c(N)c1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-amino-4,6-... CAS#:4140-68-5 |
| Literature: Montgomery,J.A.; Hewson,K. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 737 - 740 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-AMINO-4,6-DIFLUORO-2-NITRO-PHENYL)ACETAMIDE |
| 3-Amino-4.6-difluor-2-nitro-acetanilid |