Phosphonic acid,[2-[(phenylamino)carbonyl]phenyl]-, diethyl ester (9CI) structure
|
Common Name | Phosphonic acid,[2-[(phenylamino)carbonyl]phenyl]-, diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 41327-48-4 | Molecular Weight | 333.31900 | |
| Density | 1.21g/cm3 | Boiling Point | 405.5ºC at 760mmHg | |
| Molecular Formula | C17H20NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | 2-diethoxyphosphoryl-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 405.5ºC at 760mmHg |
| Molecular Formula | C17H20NO4P |
| Molecular Weight | 333.31900 |
| Flash Point | 199ºC |
| Exact Mass | 333.11300 |
| PSA | 74.44000 |
| LogP | 3.90330 |
| Index of Refraction | 1.559 |
| InChIKey | AQZWOBCHOVJTRZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)c1ccccc1C(=O)Nc1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Diethylphosphonobenzanilid |
| 2-Carboxydiethylphenylphosphorig-Saeure-Anilid |