decanedioic acid,dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol structure
|
Common Name | decanedioic acid,dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 41315-87-1 | Molecular Weight | 458.49900 | |
| Density | N/A | Boiling Point | 374.3ºC at 760mmHg | |
| Molecular Formula | C22H34O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | decanedioic acid,dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 374.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.49900 |
| Flash Point | 198.3ºC |
| Exact Mass | 458.21500 |
| PSA | 167.66000 |
| LogP | 2.50720 |
| InChIKey | UJVMVXJCVBXSAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)cc1.O=C(O)CCCCCCCCC(=O)O.OCCO |
| 1,4-Benzenedicarboxylic acid,dimethyl ester,polymer with decanedioic acid and 1,2-ethanediol |
| 1,4-Benzenedicarboxylic acid,1,4-dimethyl ester,polymer with decanedioic acid and 1,2-ethanediol |