2-triethylsilyl-1-phenylacetylene
Modify Date: 2025-08-21 16:03:37
2-triethylsilyl-1-phenylacetylene structure
|
Common Name | 2-triethylsilyl-1-phenylacetylene | ||
|---|---|---|---|---|
| CAS Number | 4131-43-5 | Molecular Weight | 216.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-triethylsilyl-1-phenylacetylene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20Si |
|---|---|
| Molecular Weight | 216.39400 |
| Exact Mass | 216.13300 |
| LogP | 4.08580 |
| InChIKey | KQSHVSCLGYGMDT-UHFFFAOYSA-N |
| SMILES | CC[Si](C#Cc1ccccc1)(CC)CC |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:536-74-3
CAS#:1504-16-1| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| triethylsilylphenylethyne |