2,4(1H,3H)-Pyrimidinedione,5-(2-methylpropyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,5-(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 41300-21-4 | Molecular Weight | 168.19300 | |
| Density | 1.093g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-methylpropyl)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19300 |
| Exact Mass | 168.09000 |
| PSA | 65.72000 |
| LogP | 0.26170 |
| Index of Refraction | 1.478 |
| InChIKey | XZBOWLOREASHJS-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1c[nH]c(=O)[nH]c1=O |
|
~80%
2,4(1H,3H)-Pyri... CAS#:41300-21-4 |
| Literature: Su; Watanabe; Schinazi; Fox Journal of Medicinal Chemistry, 1986 , vol. 29, # 1 p. 151 - 154 |
|
~%
2,4(1H,3H)-Pyri... CAS#:41300-21-4 |
| Literature: Su; Watanabe; Schinazi; Fox Journal of Medicinal Chemistry, 1986 , vol. 29, # 1 p. 151 - 154 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-isobutyluracil |
| 5-isobutyl-1H-pyrimidine-2,4-dione |