4-(chloromethyl)-7,8-dimethylchromen-2-one
Modify Date: 2025-08-27 18:32:14
4-(chloromethyl)-7,8-dimethylchromen-2-one structure
|
Common Name | 4-(chloromethyl)-7,8-dimethylchromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 41295-57-2 | Molecular Weight | 222.66800 | |
| Density | 1.236g/cm3 | Boiling Point | 364.5ºC at 760mmHg | |
| Molecular Formula | C12H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | 4-(chloromethyl)-7,8-dimethylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 364.5ºC at 760mmHg |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.66800 |
| Flash Point | 192.4ºC |
| Exact Mass | 222.04500 |
| PSA | 30.21000 |
| LogP | 3.14860 |
| Index of Refraction | 1.568 |
| InChIKey | IVPYSAYHCFQONM-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(CCl)cc(=O)oc2c1C |
| HS Code | 2932209090 |
|---|
|
~88%
4-(chloromethyl... CAS#:41295-57-2 |
| Literature: Ringh; Singh; Parkash Malik Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 11 p. 996 - 998 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloromethyl-7,8-dimethyl-2H-1-benzopyran-2-one |
| 4-(chloromethyl)-7,8-dimethyl-2H-chromen-2-one |
| 4-Chloromethyl-7,8-dimethyl-chromen-2-one |