4-methyl-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine structure
|
Common Name | 4-methyl-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine | ||
|---|---|---|---|---|
| CAS Number | 41287-10-9 | Molecular Weight | 334.45500 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H22N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.45500 |
| Exact Mass | 334.10200 |
| PSA | 122.20000 |
| LogP | 3.53640 |
| Index of Refraction | 1.561 |
| InChIKey | JLHPIYCYMLXDIC-UHFFFAOYSA-N |
| SMILES | Cc1ccnc(OCCCCCNCCSS(=O)(=O)O)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| s-[2-({5-[(4-methylpyridin-2-yl)oxy]pentyl}amino)ethyl] hydrogen sulfurothioate |
| Thiosulfuric acid,S-(2-((5-(4-methyl-2-pyridyloxy)pentyl)amino)ethyl) ester |
| Ethanethiosulfuric acid,2-(5-(4-methyl-2-pyridyloxy)pentyl)amino |
| S-2-((5-(4-Methyl-2-pyridyloxy)pentyl)amino)ethyl hydrogen thiosulfate |
| Ethanethiol,2-(5-(4-methyl-2-pyridyloxy)pentyl)amino-,hydrogen sulfate (ester) |
| 4-Picoline,2-(5-ethylaminopentyloxy)-,hydrogen thiosulfate |