2-octylundecanedioic acid
Modify Date: 2025-09-21 22:34:42
2-octylundecanedioic acid structure
|
Common Name | 2-octylundecanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4124-87-2 | Molecular Weight | 328.48700 | |
| Density | 0.99g/cm3 | Boiling Point | 487.8ºC at 760 mmHg | |
| Molecular Formula | C19H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.9ºC | |
| Name | 2-octylundecanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 487.8ºC at 760 mmHg |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.48700 |
| Flash Point | 262.9ºC |
| Exact Mass | 328.26100 |
| PSA | 74.60000 |
| LogP | 5.64320 |
| Index of Refraction | 1.473 |
| InChIKey | IGMCTDOFLKWLPJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCCCCC(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2-octylundecane... CAS#:4124-87-2 |
| Literature: Elad,D.; Rokach,J. Journal of Organic Chemistry, 1965 , vol. 30, p. 3361 - 3364 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 10-Carboxy-octadecansaeure |
| EINECS 223-931-6 |
| 10-Carboxy-stearic acid |