ethyl N-(5-acetamido-3-methyl-oxazol-4-yl)carbamate structure
|
Common Name | ethyl N-(5-acetamido-3-methyl-oxazol-4-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 41230-65-3 | Molecular Weight | 227.21700 | |
| Density | 1.33g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C9H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | ethyl N-(5-acetamido-3-methyl-isoxazol-4-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.21700 |
| Flash Point | 175.3ºC |
| Exact Mass | 227.09100 |
| PSA | 93.46000 |
| LogP | 1.65580 |
| Index of Refraction | 1.574 |
| InChIKey | LWOUHYYSDYNAEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1c(C)noc1NC(C)=O |
|
~%
ethyl N-(5-acet... CAS#:41230-65-3 |
| Literature: Abushanab,E. et al. Journal of Heterocyclic Chemistry, 1973 , vol. 10, p. 181 - 185 |
|
~%
ethyl N-(5-acet... CAS#:41230-65-3 |
| Literature: Abushanab,E. et al. Journal of Heterocyclic Chemistry, 1973 , vol. 10, p. 181 - 185 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Triaethylsilyl-buttersaeure-aethylester |
| Aethyl-4-triaethylsilyl-butyrat |
| Aethyl-5-acetamido-3-methylisoxazolo-4-carbamat |