dithicrofos
Modify Date: 2024-07-17 11:04:26
dithicrofos structure
|
Common Name | dithicrofos | ||
|---|---|---|---|---|
| CAS Number | 41219-31-2 | Molecular Weight | 368.90300 | |
| Density | 1.35g/cm3 | Boiling Point | 437.5ºC at 760mmHg | |
| Molecular Formula | C13H18ClO2PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.4ºC | |
| Name | dithicrofos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 437.5ºC at 760mmHg |
| Molecular Formula | C13H18ClO2PS3 |
| Molecular Weight | 368.90300 |
| Flash Point | 218.4ºC |
| Exact Mass | 367.99000 |
| PSA | 110.96000 |
| LogP | 6.55820 |
| Index of Refraction | 1.617 |
| InChIKey | QNZZKGBRJAVCIQ-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SC1CCSc2ccc(Cl)cc21 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| S-[(RS)-6-chloro-3,4-dihydro-2H-1-benzothiin-4-yl] O,O-diethyl phosphorodithioate |
| S-(6-Chloro-3,4-dihydro-2H-thiochromen-4-yl) O,O-diethyl phosphor odithioate |
| S-(6-chloro-3,4-dihydro-2H-1-benzothiopyran-4-yl) O,O-diethyl phosphorodithioate |
| rac-S-[(4R)-6-chloro-3,4-dihydro-2H-1-benzothiopyran-4-yl] O,O-diethyl phosphorodithioate |