benzyl butyl adipate
Modify Date: 2025-09-24 15:05:40
benzyl butyl adipate structure
|
Common Name | benzyl butyl adipate | ||
|---|---|---|---|---|
| CAS Number | 4121-13-5 | Molecular Weight | 292.37000 | |
| Density | 1.052g/cm3 | Boiling Point | 377.9ºC at 760mmHg | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 6-O-benzyl 1-O-butyl hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760mmHg |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37000 |
| Flash Point | 180ºC |
| Exact Mass | 292.16700 |
| PSA | 52.60000 |
| LogP | 3.63350 |
| Index of Refraction | 1.495 |
| InChIKey | VRFMFQHSDWKYDM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCCCC(=O)OCc1ccccc1 |
| HS Code | 2917120090 |
|---|
| HS Code | 2917120090 |
|---|---|
| Summary | 2917120090. adipic acid and its salts. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Butyl benzyladipinate |
| Benzyl butyl adipate |
| ADIPIC ACID,BENZYL BUTYL ESTER |
| Hexanedioic acid,butyl phenylmethyl ester |
| EINECS 223-915-9 |
| Adimoll BB |