2-amino-4-[4-(3-amino-4-hydroxy-phenyl)hexan-3-yl]phenol structure
|
Common Name | 2-amino-4-[4-(3-amino-4-hydroxy-phenyl)hexan-3-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 41172-52-5 | Molecular Weight | 300.39500 | |
| Density | 1.192g/cm3 | Boiling Point | 466.5ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | 3,3'-Diaminohexestrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 466.5ºC at 760 mmHg |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.39500 |
| Flash Point | 235.9ºC |
| Exact Mass | 300.18400 |
| PSA | 92.50000 |
| LogP | 5.11200 |
| Index of Refraction | 1.642 |
| InChIKey | UTINGAQXLPFZLX-UHFFFAOYSA-N |
| SMILES | CCC(c1ccc(O)c(N)c1)C(CC)c1ccc(O)c(N)c1 |
|
~10%
2-amino-4-[4-(3... CAS#:41172-52-5 |
| Literature: Hartmann, Rolf W.; Schwarz, Walter; Schoenenberger, Helmut Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1137 - 1144 |
|
~%
2-amino-4-[4-(3... CAS#:41172-52-5 |
| Literature: Hartmann, Rolf W.; Schwarz, Walter; Schoenenberger, Helmut Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1137 - 1144 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2'-diamino-3,5,3',5'-tetrabromodiphenyl |
| 3,4-Bis-(3-amino-4-hydroxy-phenyl)-hexan |
| 2,2'-diamino-3,3',5,5'-tetrabromobiphenyl |
| 2,2'-Diamino-4,4'-(1,2-diaethyl-aethandiyl)-di-phenol |
| meso-4,4'-(1,2-Diethylethylen)bis(2-aminophenol) |
| 2,2'-diamino-4,4'-(1,2-diethyl-ethanediyl)-di-phenol |
| 2,2'-Diamino-3,5,3',5'-tetrabrom-biphenyl |