2,2,3,3-tetraethylbutanedioic acid
Modify Date: 2025-09-13 10:58:14
2,2,3,3-tetraethylbutanedioic acid structure
|
Common Name | 2,2,3,3-tetraethylbutanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4111-60-8 | Molecular Weight | 230.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3-tetraethylbutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22O4 |
|---|---|
| Molecular Weight | 230.30100 |
| Exact Mass | 230.15200 |
| PSA | 74.60000 |
| LogP | 2.76840 |
| InChIKey | CQCFISPMNREOQX-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C(=O)O)C(CC)(CC)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2,2,3,3-tetraet... CAS#:4111-60-8 |
| Literature: Eberson,L.; Welinder,H. Journal of the American Chemical Society, 1971 , vol. 93, # 22 p. 5821 - 5826 |
|
~%
Detail
|
| Literature: Dox Journal of the American Chemical Society, 1925 , vol. 47, p. 1475 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Tetraaethyl Bernsteinsaeure |
| Butanedioic acid,tetraethyl |
| tetraethylsuccinic acid |
| Tetraethyl-bernsteinsaeure |