L-870810 structure
|
Common Name | L-870810 | ||
|---|---|---|---|---|
| CAS Number | 410544-95-5 | Molecular Weight | 430.45 | |
| Density | 1.471g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H19FN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-870810L-870810 is a potent HIV-1 IN chain transfer inhibitor with antiviral activity[1]. |
| Name | 5-(1,1-Dioxido-1,2-thiazinan-2-yl)-N-(4-fluorobenzyl)-8-hydroxy-1 ,6-naphthyridine-7-carboximidic acid |
|---|
| Description | L-870810 is a potent HIV-1 IN chain transfer inhibitor with antiviral activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.471g/cm3 |
|---|---|
| Molecular Formula | C20H19FN4O4S |
| Molecular Weight | 430.45 |
| Exact Mass | 430.11100 |
| PSA | 124.36000 |
| LogP | 4.05510 |
| Index of Refraction | 1.663 |
| InChIKey | DIDKWCOCQJWMDJ-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccc(F)cc1)c1nc(N2CCCCS2(=O)=O)c2cccnc2c1O |