Butanamide,N,N'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3-oxo- structure
|
Common Name | Butanamide,N,N'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 4104-12-5 | Molecular Weight | 412.43600 | |
| Density | 1.253g/cm3 | Boiling Point | 632.9ºC at 760mmHg | |
| Molecular Formula | C22H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.6ºC | |
| Name | N-[2-methoxy-4-[3-methoxy-4-(3-oxobutanoylamino)phenyl]phenyl]-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 632.9ºC at 760mmHg |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.43600 |
| Flash Point | 336.6ºC |
| Exact Mass | 412.16300 |
| PSA | 110.80000 |
| LogP | 3.35200 |
| Index of Refraction | 1.591 |
| InChIKey | QCGJBSHPJVTZSR-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccc(NC(=O)CC(C)=O)c(OC)c2)ccc1NC(=O)CC(C)=O |
| HS Code | 2924299090 |
|---|
|
~%
Butanamide,N,N'... CAS#:4104-12-5 |
| Literature: Chem.Fabr.Griesheim-Elektron Patent: DE415023 ; Full Text Show Details Chem.Fabr.Griesheim-Elektron Patent: DE386054 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 1006,1487 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diacetoacet-o-dianisidid |
| EINECS 223-873-1 |
| Diacetessigsaeure-o-dianisidid |
| 4,4'-Bis-acetoacetylamino-3,3'-dimethoxy-biphenyl |
| N.N'-Bis-acetoacetyl-o-dianisidin |
| N,N'-Diacetylacetyl-dianisidin |