Phenol,2-methyl-4,6-dinitro-, 1-benzoate structure
|
Common Name | Phenol,2-methyl-4,6-dinitro-, 1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 4102-92-5 | Molecular Weight | 302.23900 | |
| Density | 1.42g/cm3 | Boiling Point | 532.7ºC at 760mmHg | |
| Molecular Formula | C14H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.6ºC | |
| Name | (2-methyl-4,6-dinitrophenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 532.7ºC at 760mmHg |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.23900 |
| Flash Point | 246.6ºC |
| Exact Mass | 302.05400 |
| PSA | 117.94000 |
| LogP | 4.07700 |
| Index of Refraction | 1.631 |
| InChIKey | YUDBQBRGLHGEOM-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)c1ccccc1 |
|
~%
Phenol,2-methyl... CAS#:4102-92-5 |
| Literature: Wain Annals of Applied Biology, 1942 , vol. 29, p. 301,304 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (4.6-Dinitro-2-methyl-phenyl)-benzoat |
| O-Cresol,4,6-dinitro-,benzoate |
| Benzoesaeure-(2-methyl-4,6-dinitro-phenylester) |
| benzoic acid-(2-methyl-4,6-dinitro-phenyl ester) |
| 3.5-Dinitro-2-benzoyloxy-toluol |