1H-Purine-2,6-dione,3,7-dihydro-3,7-dimethyl-8-(methylthio)-
Modify Date: 2024-07-18 23:00:03
1H-Purine-2,6-dione,3,7-dihydro-3,7-dimethyl-8-(methylthio)- structure
|
Common Name | 1H-Purine-2,6-dione,3,7-dihydro-3,7-dimethyl-8-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 40959-23-7 | Molecular Weight | 226.25600 | |
| Density | 1.59g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,7-dimethyl-8-methylsulfanylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.25600 |
| Exact Mass | 226.05200 |
| PSA | 97.98000 |
| Index of Refraction | 1.741 |
| InChIKey | PMWPLYPRAQKOAU-UHFFFAOYSA-N |
| SMILES | CSc1nc2c(c(=O)[nH]c(=O)n2C)n1C |
| HS Code | 2933990090 |
|---|
|
~%
1H-Purine-2,6-d... CAS#:40959-23-7 |
| Literature: Biltz; Beck Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2>118, p. 161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-dimethyl-8-(methylsulfanyl)-3,7-dihydro-1h-purine-2,6-dione |
| 3,7-Dimethyl-8-methylmercapto-3,7-dihydro-purin-2,6-dion |
| 3,7-dimethyl-8-methylsulfanyl-3,7-dihydro-purine-2,6-dione |
| 3,7-Dimethyl-8-methylthioxanthin |