2,3,6-trichlorobenzoyl chloride structure
|
Common Name | 2,3,6-trichlorobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4093-17-8 | Molecular Weight | 243.90200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2Cl4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,6-trichlorobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H2Cl4O |
|---|---|
| Molecular Weight | 243.90200 |
| Exact Mass | 241.88600 |
| PSA | 17.07000 |
| LogP | 4.02580 |
| InChIKey | BOBWPULZPJBMFP-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1c(Cl)ccc(Cl)c1Cl |
| HS Code | 2916399090 |
|---|
|
~%
2,3,6-trichloro... CAS#:4093-17-8 |
| Literature: Du Pont de Nemours and Co. Patent: US2854325 , 1957 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3,6-Trichlor-benzoylchlorid |
| Benzoyl chloride,2,3,6-trichloro |
| 2,3,6-trichlorobenzoic acid chloride |
| 2,3,6-trichloro-benzoyl chloride |