butyl prop-2-enoate,N-(methoxymethyl)-2-methylprop-2-enamide,styrene structure
|
Common Name | butyl prop-2-enoate,N-(methoxymethyl)-2-methylprop-2-enamide,styrene | ||
|---|---|---|---|---|
| CAS Number | 40884-08-0 | Molecular Weight | 361.47500 | |
| Density | N/A | Boiling Point | 145.9ºC at 760mmHg | |
| Molecular Formula | C21H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.4ºC | |
| Name | butyl prop-2-enoate,N-(methoxymethyl)-2-methylprop-2-enamide,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.47500 |
| Flash Point | 39.4ºC |
| Exact Mass | 361.22500 |
| PSA | 68.12000 |
| LogP | 4.96820 |
| InChIKey | VBSRJELRIOMUJQ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NCOC.C=CC(=O)OCCCC.C=Cc1ccccc1 |
| 2-Propenoic acid,butyl ester,polymer with ethenylbenzene and N-(methoxymethyl)-2-methyl-2-propenamide |