2-aminoperimidine structure
|
Common Name | 2-aminoperimidine | ||
|---|---|---|---|---|
| CAS Number | 40835-96-9 | Molecular Weight | 183.209 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 421.7±28.0 °C at 760 mmHg | |
| Molecular Formula | C11H10BrN3 | Melting Point | 295-300 °C | |
| MSDS | USA | Flash Point | 208.8±24.0 °C | |
| Name | 2-Aminoperimidine Hydrobromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.7±28.0 °C at 760 mmHg |
| Melting Point | 295-300 °C |
| Molecular Formula | C11H10BrN3 |
| Molecular Weight | 183.209 |
| Flash Point | 208.8±24.0 °C |
| Exact Mass | 183.079651 |
| PSA | 54.70000 |
| LogP | 1.36 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.760 |
| InChIKey | HFZUTZWRTHBWPV-UHFFFAOYSA-N |
| SMILES | Br.NC1=Nc2cccc3cccc(c23)N1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2933990090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Perimidylammonium bromide |
| 1H-perimidin-2-amine,hydrobromide |
| MFCD00012749 |
| 1H-Perimidin-2-amine |
| 2-aminoperimidine |
| EINECS 255-101-4 |