5-chloro-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine
Modify Date: 2025-09-21 17:13:02
![5-chloro-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine Structure](https://image.chemsrc.com/caspic/358/40771-31-1.png)
5-chloro-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine structure
|
Common Name | 5-chloro-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine | ||
|---|---|---|---|---|
| CAS Number | 40771-31-1 | Molecular Weight | 354.87300 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H19ClN2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-2-[5-(2-sulfosulfanylethylamino)pentoxy]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C12H19ClN2O4S2 |
| Molecular Weight | 354.87300 |
| Exact Mass | 354.04700 |
| PSA | 122.20000 |
| LogP | 3.88140 |
| Index of Refraction | 1.574 |
| InChIKey | JTRXPPVLPJRQIF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)SCCNCCCCCOc1ccc(Cl)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| S-2-((5-(5-Chloro-2-pyridyloxy)pentyl)amino)ethyl hydrogen thiosulfate |
| s-[2-({5-[(5-chloropyridin-2-yl)oxy]pentyl}amino)ethyl] hydrogen sulfurothioate |
| Ethanethiosulfuric acid,2-(5-(5-chloro-2-pyridyloxy)pentyl)amino |
| Ethanethiol,2-(5-(5-chloro-2-pyridyloxy)pentyl)amino-,hydrogen sulfate (ester) |
| Thiosulfuric acid,S-(2-((5-(5-chloro-2-pyridyloxy)pentyl)amino)ethyl) ester |