ethyl 2-cyano-3-(3,5,6-trimethylbenzofuran-2-yl)prop-2-enoate structure
|
Common Name | ethyl 2-cyano-3-(3,5,6-trimethylbenzofuran-2-yl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 40763-18-6 | Molecular Weight | 283.32200 | |
| Density | 1.169g/cm3 | Boiling Point | 439.3ºC at 760 mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.5ºC | |
| Name | ethyl 2-cyano-3-(3,5,6-trimethyl-1-benzofuran-2-yl)prop-2-enoate |
|---|
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 439.3ºC at 760 mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 219.5ºC |
| Exact Mass | 283.12100 |
| PSA | 63.23000 |
| LogP | 3.82808 |
| Index of Refraction | 1.593 |
| InChIKey | IVJBSYSDQNAOHJ-JYRVWZFOSA-N |
| SMILES | CCOC(=O)C(C#N)=Cc1oc2cc(C)c(C)cc2c1C |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |