N-(4,5-diphenyltriazol-1-yl)-4-methylbenzenesulfonamide structure
|
Common Name | N-(4,5-diphenyltriazol-1-yl)-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 40679-60-5 | Molecular Weight | 390.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4,5-diphenyltriazol-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18N4O2S |
|---|---|
| Molecular Weight | 390.45800 |
| Exact Mass | 390.11500 |
| PSA | 85.26000 |
| LogP | 5.00670 |
| InChIKey | GUMYXRFAEIBEHR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nn2nnc(-c3ccccc3)c2-c2ccccc2)cc1 |
|
~93%
N-(4,5-diphenyl... CAS#:40679-60-5 |
| Literature: Singh; Mishra; Misra Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 4 p. 1233 - 1236 |
| Benzenesulfonamide,N-(4,5-diphenyl-1H-1,2,3-triazol-1-yl)-4-methyl |
| 4,5-Diphenyl-1-(p-tosylamido)-1,2,3-triazol |
| N-(4,5-diphenyl-[1,2,3]triazol-1-yl)-toluene-4-sulfonamide |
| N-(4,5-Diphenyl-1,2,3-triazol-1-yl)-p-toluolsulfonamid |
| 4,5-Diphenyl-1-(toluol-4-sulfonylamino)-1,2,3-triazol |
| 4,5-diphenyl-1-tosylamino-1,2,3-triazole |