5-methyl-5-nitro-2-phenyl-1,3-dioxane structure
|
Common Name | 5-methyl-5-nitro-2-phenyl-1,3-dioxane | ||
|---|---|---|---|---|
| CAS Number | 4064-91-9 | Molecular Weight | 223.22500 | |
| Density | 1.24g/cm3 | Boiling Point | 352.5ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | 5-methyl-5-nitro-2-phenyl-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 352.5ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 159.7ºC |
| Exact Mass | 223.08400 |
| PSA | 64.28000 |
| LogP | 2.29060 |
| Vapour Pressure | 3.82E-05mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | DOQXGNKUXOJWPP-UHFFFAOYSA-N |
| SMILES | CC1([N+](=O)[O-])COC(c2ccccc2)OC1 |
|
~%
5-methyl-5-nitr... CAS#:4064-91-9 |
| Literature: Senkus Journal of the American Chemical Society, 1941 , vol. 63, p. 2635 Journal of the American Chemical Society, 1943 , vol. 65, p. 1656 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Methyl-5-nitro-2-phenyl-1,3-dioxan |
| 1,3-Dioxane,5-methyl-5-nitro-2-phenyl |
| DOQXGNKUXOJWPP-PHIMTYICSA |