trimethyl(phenylsilyl)silane
Modify Date: 2025-08-27 17:49:37
trimethyl(phenylsilyl)silane structure
|
Common Name | trimethyl(phenylsilyl)silane | ||
|---|---|---|---|---|
| CAS Number | 40633-37-2 | Molecular Weight | 180.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(phenylsilyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H16Si2 |
|---|---|
| Molecular Weight | 180.39400 |
| Exact Mass | 180.07900 |
| LogP | 1.31560 |
| InChIKey | BBSJLSBCBPEHTR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[SiH2]c1ccccc1 |
|
~%
trimethyl(pheny... CAS#:40633-37-2 |
| Literature: Maier, Guenther; Reisenauer, Hans Peter; Jung, Joerg; Pacl, Harald; Egenolf, Heiko European Journal of Organic Chemistry, 1998 , # 7 p. 1297 - 1305 |
|
~%
trimethyl(pheny... CAS#:40633-37-2 |
| Literature: Becerra, Rosa; Frey, H. Monty; Mason, Ben P.; Walsh, Robin Journal of the Chemical Society, Faraday Transactions, 1993 , vol. 89, # 3 p. 411 - 418 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Disilane,1,1,1-trimethyl-2-phenyl |
| Me3SiSiH2Ph |
| 1,1,1-trimethyl-2-phenyldisilan |
| phenyl(trimethylsilyl)silylene |