1-(hydroxymethyl)-7-phenyl-3-oxa-8-thia-6-azabicyclo[3.3.0]octan-4-one
Modify Date: 2025-08-25 03:04:45
![1-(hydroxymethyl)-7-phenyl-3-oxa-8-thia-6-azabicyclo[3.3.0]octan-4-one Structure](https://image.chemsrc.com/caspic/099/4063-32-5.png)
1-(hydroxymethyl)-7-phenyl-3-oxa-8-thia-6-azabicyclo[3.3.0]octan-4-one structure
|
Common Name | 1-(hydroxymethyl)-7-phenyl-3-oxa-8-thia-6-azabicyclo[3.3.0]octan-4-one | ||
|---|---|---|---|---|
| CAS Number | 4063-32-5 | Molecular Weight | 251.30200 | |
| Density | 1.369g/cm3 | Boiling Point | 519.8ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.2ºC | |
| Name | 6a-(hydroxymethyl)-2-phenyl-2,3,3a,6-tetrahydrofuro[3,4-d][1,3]thiazol-4-one |
|---|
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 519.8ºC at 760 mmHg |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.30200 |
| Flash Point | 268.2ºC |
| Exact Mass | 251.06200 |
| PSA | 83.86000 |
| LogP | 1.00690 |
| Vapour Pressure | 1.24E-11mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | BFOKIVXRLAGCCU-UHFFFAOYSA-N |
| SMILES | O=C1OCC2(CO)SC(c3ccccc3)NC12 |
|
~%
1-(hydroxymethy... CAS#:4063-32-5 |
| Literature: Stork,G.; Cheung,H.T. Journal of the American Chemical Society, 1965 , vol. 87, p. 3783 - 3784 |
|
~%
1-(hydroxymethy... CAS#:4063-32-5 |
| Literature: Stork,G.; Cheung,H.T. Journal of the American Chemical Society, 1965 , vol. 87, p. 3783 - 3784 |
![[3-acetyloxy-2-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)propyl] acetate structure](https://image.chemsrc.com/caspic/406/92964-25-5.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |