Benzenamine,N-[(5-nitro-2-thienyl)methylene]- structure
|
Common Name | Benzenamine,N-[(5-nitro-2-thienyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 40619-46-3 | Molecular Weight | 232.25800 | |
| Density | 1.31g/cm3 | Boiling Point | 387.4ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | 1-(5-nitrothiophen-2-yl)-N-phenylmethanimine |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 387.4ºC at 760 mmHg |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.25800 |
| Flash Point | 188.1ºC |
| Exact Mass | 232.03100 |
| PSA | 86.42000 |
| LogP | 3.93010 |
| Index of Refraction | 1.65 |
| InChIKey | VBPXOOMRBYTVBT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Nc2ccccc2)s1 |
|
~72%
Benzenamine,N-[... CAS#:40619-46-3 |
| Literature: Gayral Ph.; Rigothier; Gantier; et al. European Journal of Medicinal Chemistry, 1981 , vol. 16, # 2 p. 151 - 155 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |