2-methylhexanoyl 2-methylhexanoate
Modify Date: 2025-08-28 11:45:50
2-methylhexanoyl 2-methylhexanoate structure
|
Common Name | 2-methylhexanoyl 2-methylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 40607-84-9 | Molecular Weight | 242.35400 | |
| Density | 0.929g/cm3 | Boiling Point | 273.288ºC at 760 mmHg | |
| Molecular Formula | C14H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.686ºC | |
| Name | 2-methylhexanoyl 2-methylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929g/cm3 |
|---|---|
| Boiling Point | 273.288ºC at 760 mmHg |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.35400 |
| Flash Point | 121.686ºC |
| Exact Mass | 242.18800 |
| PSA | 43.37000 |
| LogP | 3.70880 |
| Index of Refraction | 1.439 |
| InChIKey | KRFHNSRRDDKHDT-UHFFFAOYSA-N |
| SMILES | CCCCC(C)C(=O)OC(=O)C(C)CCCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2-Methylhexanoic anhydride |
| Hexanoicacid,2-methyl-,anhydride (9CI) |
| Hexanoic acid,2-methyl-,anhydride with 2-methylhexanoic acid |