3.5-Dinitro-benzoesaeure-<1-methyl-propylester>
Modify Date: 2025-08-26 16:10:15
3.5-Dinitro-benzoesaeure-<1-methyl-propylester> structure
|
Common Name | 3.5-Dinitro-benzoesaeure-<1-methyl-propylester> | ||
|---|---|---|---|---|
| CAS Number | 40572-64-3 | Molecular Weight | 424.57400 | |
| Density | 1.115g/cm3 | Boiling Point | 562.1ºC at 760 mmHg | |
| Molecular Formula | C30H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
| Name | 3.5-Dinitro-benzoesaeure-<1-methyl-propylester> |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 562.1ºC at 760 mmHg |
| Molecular Formula | C30H32O2 |
| Molecular Weight | 424.57400 |
| Flash Point | 205.6ºC |
| Exact Mass | 424.24000 |
| PSA | 34.14000 |
| LogP | 6.02080 |
| Index of Refraction | 1.586 |
| InChIKey | SLAKMYBNIIJMQO-UHFFFAOYSA-N |
| SMILES | CC1=CC2C(C3C=CC2(C)C(=O)C3(C)Cc2ccccc2)C(C)(Cc2ccccc2)C1=O |
|
~%
3.5-Dinitro-ben... CAS#:40572-64-3 |
| Literature: Curtin et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 1391,1397 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| sec-butyl 3,5-dinitrobenzoate |
| Benzoic acid,3,5-dinitro-,sec-butyl ester |
| Benzoic acid,5-dinitro-,sec-butyl ester |