3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one
Modify Date: 2025-10-03 19:41:35
![3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one Structure](https://image.chemsrc.com/caspic/356/40550-34-3.png)
3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one structure
|
Common Name | 3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 40550-34-3 | Molecular Weight | 338.34700 | |
| Density | 1.4g/cm3 | Boiling Point | 526.3ºC at 760 mmHg | |
| Molecular Formula | C16H13F3N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.1ºC | |
| Name | 3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 526.3ºC at 760 mmHg |
| Molecular Formula | C16H13F3N2OS |
| Molecular Weight | 338.34700 |
| Flash Point | 272.1ºC |
| Exact Mass | 338.07000 |
| PSA | 71.63000 |
| LogP | 4.94880 |
| Index of Refraction | 1.605 |
| InChIKey | QVEUKHRUDUMXID-UHFFFAOYSA-N |
| SMILES | NCCC(=O)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS652O09 |
| Dediethylftoracizin |