3,3,13,13-tetramethoxy-2,14-dioxa-7,8,9-trithia-3,13-disilapentadecane structure
|
Common Name | 3,3,13,13-tetramethoxy-2,14-dioxa-7,8,9-trithia-3,13-disilapentadecane | ||
|---|---|---|---|---|
| CAS Number | 40550-17-2 | Molecular Weight | 422.72900 | |
| Density | 1.117g/cm3 | Boiling Point | 398.8ºC at 760mmHg | |
| Molecular Formula | C12H30O6S3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | trimethoxy-[3-(3-trimethoxysilylpropyltrisulfanyl)propyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 398.8ºC at 760mmHg |
| Molecular Formula | C12H30O6S3Si2 |
| Molecular Weight | 422.72900 |
| Flash Point | 195ºC |
| Exact Mass | 422.07400 |
| PSA | 131.28000 |
| LogP | 3.55240 |
| Index of Refraction | 1.491 |
| InChIKey | KOFGNZOFJYBHIN-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCSSSCCC[Si](OC)(OC)OC)(OC)OC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,14-Dioxa-7,8,9-trithia-3,13-disilapentadecane,3,3,13,13-tetramethoxy |
| [(MeO)3Si(CH2)3]2S3 |
| Bis-Trimethoxysilylpropyltrisulfan |
| 1,3-Bis[3-(trimethoxysilyl)propyl]trisulfide |
| Bis-(3-trimethoxysilylpropyl)trisulfid |
| EINECS 254-971-2 |
| Bis[3-(trimethoxysilyl)propyl] trisulfide |
| Bis(g-trimethoxysilylpropyl)trisulfide |
| 3,3,13,13-Tetramethoxy-2,14-dioxa-7,8,9-trithia-3,13-disilapentadecane |