Ethyl 4-nitrobenzenecarboximidate hydrochloride (1:1) structure
|
Common Name | Ethyl 4-nitrobenzenecarboximidate hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 40546-45-0 | Molecular Weight | 230.64800 | |
| Density | N/A | Boiling Point | 314.9ºC at 760 mmHg | |
| Molecular Formula | C9H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.2ºC | |
| Name | Ethyl 4-nitrobenzenecarboximidate hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 314.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.64800 |
| Flash Point | 144.2ºC |
| Exact Mass | 230.04600 |
| PSA | 78.90000 |
| LogP | 3.38160 |
| InChIKey | UFCWXDCMAFVBLL-UHFFFAOYSA-N |
| SMILES | CCOC(=N)c1ccc([N+](=O)[O-])cc1.Cl |
|
~89%
Ethyl 4-nitrobe... CAS#:40546-45-0 |
| Literature: Kelly, David P.; Bateman, Stuart A.; Hook, Robert J.; Martin, Roger F.; Reum, Monica E.; et al. Australian Journal of Chemistry, 1994 , vol. 47, # 9 p. 1751 - 1770 |
|
~88%
Ethyl 4-nitrobe... CAS#:40546-45-0 |
| Literature: The Green Cross Corporation Patent: US5948785 A1, 1999 ; US 5948785 A |
| 4-nitro-benzimidic acid ethyl ester,hydrochloride |
| METHYLPHOSPHINIC ACID ETHYL ESTER |
| O-ethyl methylphosphonous acid |
| ethyl p-nitrobenzimidate hydrochloride |
| methylphosphinic acid methyl ester |
| ethyl methylphosphinate |
| 4-Nitro-benzimidsaeure-aethylester,Hydrochlorid |
| ethyl 4-nitrobenzenecarboximidoate hydrochloride |
| ethylphosphinic acid,ethyl ester |
| Ethyl 4-nitrobenzimidate hydrochloride |
| O-Ethyl methylphosphinic acid) |
| ethyl P-methylphosphinate |