4-Oxo-1,9a-dihydro-4H-pyrimido[1,2-a]pyrimidine-3-carboxylic acid ethyl ester
Modify Date: 2025-09-02 15:57:59
![4-Oxo-1,9a-dihydro-4H-pyrimido[1,2-a]pyrimidine-3-carboxylic acid ethyl ester Structure](https://image.chemsrc.com/caspic/498/40519-95-7.png)
4-Oxo-1,9a-dihydro-4H-pyrimido[1,2-a]pyrimidine-3-carboxylic acid ethyl ester structure
|
Common Name | 4-Oxo-1,9a-dihydro-4H-pyrimido[1,2-a]pyrimidine-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 40519-95-7 | Molecular Weight | 221.21300 | |
| Density | 1.4g/cm3 | Boiling Point | 435.7ºC at 760 mmHg | |
| Molecular Formula | C10H11N3O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 217.3ºC | |
| Name | 4-Oxo-1,9a-dihydro-4H-pyrimido[1,2-a]pyrimidine-3-carboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 435.7ºC at 760 mmHg |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.21300 |
| Flash Point | 217.3ºC |
| Exact Mass | 221.08000 |
| PSA | 71.00000 |
| Index of Refraction | 1.639 |
| InChIKey | MFUYUKXJPSKDCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2N=CC=CN2C1=O |
| HS Code | 2933599090 |
|---|
|
~99%
4-Oxo-1,9a-dihy... CAS#:40519-95-7 |
| Literature: Prager, Rolf H.; Singh, Yogendra Australian Journal of Chemistry, 1994 , vol. 47, # 7 p. 1263 - 1270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid |
| 4-Oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid hydrochloride |
| 4-Oxo-4H-pyrido[1,2-a]pyrimidin-3-carbonsaeure |
| 4-oxo-4H-pyrido[1,2-a]-3-carboxylic acid |
| ethyl 4-oxo-4H-pyrimido<1,2-a>pyrimidine-3-carboxylate |
| 4-oxo-4H-pyrimido[1,2-a]pyrimidine-3-carboxylic acid ethyl ester |