4-Chloro-7-trifluoro methoxyquinoline structure
|
Common Name | 4-Chloro-7-trifluoro methoxyquinoline | ||
|---|---|---|---|---|
| CAS Number | 40516-31-2 | Molecular Weight | 247.60100 | |
| Density | 1.464g/cm3 | Boiling Point | 259.4ºC at 760mmHg | |
| Molecular Formula | C10H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.7ºC | |
| Name | 4-chloro-7-(trifluoromethoxy)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 259.4ºC at 760mmHg |
| Molecular Formula | C10H5ClF3NO |
| Molecular Weight | 247.60100 |
| Flash Point | 110.7ºC |
| Exact Mass | 247.00100 |
| PSA | 22.12000 |
| LogP | 3.78680 |
| Index of Refraction | 1.554 |
| InChIKey | IMYQYVHUVHLCOX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1ccc2c(Cl)ccnc2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-7-Trifluoro Methoxyquinoline |