Indanazoline
Modify Date: 2025-08-22 10:39:54
Indanazoline structure
|
Common Name | Indanazoline | ||
|---|---|---|---|---|
| CAS Number | 40507-78-6 | Molecular Weight | 201.26800 | |
| Density | 1.3g/cm3 | Boiling Point | 329.2ºC at 760 mmHg | |
| Molecular Formula | C12H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.9ºC | |
Use of IndanazolineIndanazoline (as monohydrochloride active substance of Farial) is characterized by a pronounced vasoconstrictive action. |
| Name | N-(2,3-dihydro-1H-inden-4-yl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Indanazoline (as monohydrochloride active substance of Farial) is characterized by a pronounced vasoconstrictive action. |
|---|---|
| Related Catalog | |
| In Vivo | In animal experiments the new imidazoline derivative indanazoline (as monohydrochloride active substance of Farial) is characterized by a pronounced vasoconstrictive action after local or intravenous application[1]. |
| References |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 329.2ºC at 760 mmHg |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.26800 |
| Flash Point | 152.9ºC |
| Exact Mass | 201.12700 |
| PSA | 36.42000 |
| LogP | 1.38380 |
| Index of Refraction | 1.695 |
| InChIKey | KUCWWEPJRBANHL-UHFFFAOYSA-N |
| SMILES | c1cc2c(c(NC3=NCCN3)c1)CCC2 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indanazolinum [Latin] |
| Indanazolinum |
| Indanazoline (INN) |
| Indanazoline |
| Indanazolin |
| (4,5-dihydro-1H-imidazol-2-yl)-indan-4-yl-amine |
| Indanazolina |
| 2-(4-Indanylamino)-2-imidazolin |
| Indanazolina [Spanish] |