3-(2-bromoethoxy)-4-nitrobenzaldehyde structure
|
Common Name | 3-(2-bromoethoxy)-4-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 404335-88-2 | Molecular Weight | 274.06800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-bromoethoxy)-4-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8BrNO4 |
|---|---|
| Molecular Weight | 274.06800 |
| Exact Mass | 272.96400 |
| PSA | 72.12000 |
| LogP | 2.70420 |
| InChIKey | LVGWNZJMXREFRX-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc([N+](=O)[O-])c(OCCBr)c1 |
|
~75%
3-(2-bromoethox... CAS#:404335-88-2 |
| Literature: Gee, Kyle R.; Zhou, Zhang-Lin; Qian, Wei-Jun; Kennedy, Robert Journal of the American Chemical Society, 2002 , vol. 124, # 5 p. 776 - 778 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzaldehyde,3-(2-bromoethoxy)-4-nitro |