Urea,N-(4-chlorophenyl)-N'-(4-fluorophenyl)- structure
|
Common Name | Urea,N-(4-chlorophenyl)-N'-(4-fluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 404-51-3 | Molecular Weight | 264.68300 | |
| Density | 1.422g/cm3 | Boiling Point | 289.8ºC at 760mmHg | |
| Molecular Formula | C13H10ClFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129ºC | |
| Name | 1-(4-chlorophenyl)-3-(4-fluorophenyl)urea |
|---|
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 289.8ºC at 760mmHg |
| Molecular Formula | C13H10ClFN2O |
| Molecular Weight | 264.68300 |
| Flash Point | 129ºC |
| Exact Mass | 264.04700 |
| PSA | 41.13000 |
| LogP | 4.26910 |
| Vapour Pressure | 0.00216mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | MMAPXNAETQDQNW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N-(4-chlor... CAS#:404-51-3 |
| Literature: Miyahara Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 5 p. 1950 - 1960 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |