3-bromo-2-(trifluoromethoxy)benzoic acid
Modify Date: 2025-08-25 15:05:39
3-bromo-2-(trifluoromethoxy)benzoic acid structure
|
Common Name | 3-bromo-2-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 403646-45-7 | Molecular Weight | 285.01500 | |
| Density | 1.798g/cm3 | Boiling Point | 280.957ºC at 760 mmHg | |
| Molecular Formula | C8H4BrF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.719ºC | |
| Name | 3-bromo-2-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.798g/cm3 |
|---|---|
| Boiling Point | 280.957ºC at 760 mmHg |
| Molecular Formula | C8H4BrF3O3 |
| Molecular Weight | 285.01500 |
| Flash Point | 123.719ºC |
| Exact Mass | 283.93000 |
| PSA | 46.53000 |
| LogP | 3.04590 |
| Index of Refraction | 1.518 |
| InChIKey | CSHDITITKWDULQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Br)c1OC(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-bromo-2-(triflu oromethoxy)benzoic acid |