5-(3,4-dichlorobutyl)pyridine-2-carboxylic acid structure
|
Common Name | 5-(3,4-dichlorobutyl)pyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 40342-77-6 | Molecular Weight | 248.10600 | |
| Density | 1.347g/cm3 | Boiling Point | 439ºC at 760 mmHg | |
| Molecular Formula | C10H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | 5-(3,4-dichlorobutyl)pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760 mmHg |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.10600 |
| Flash Point | 219.3ºC |
| Exact Mass | 247.01700 |
| PSA | 50.19000 |
| LogP | 2.55860 |
| Index of Refraction | 1.562 |
| InChIKey | LQSDMYANSZGGQH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(CCC(Cl)CCl)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarboxylic acid,5-(3,4-dichlorobutyl) |
| 5-(3,4-Dichlorobutyl)-2-pyridinecarboxylic acid |
| 10,11-Dichlorfusarsaeure |
| 5-(3,4-Dichlorobutyl)picolinic acid |