chembrdg-bb 5245899
Modify Date: 2025-08-31 20:35:44
chembrdg-bb 5245899 structure
|
Common Name | chembrdg-bb 5245899 | ||
|---|---|---|---|---|
| CAS Number | 40337-11-9 | Molecular Weight | 316.14900 | |
| Density | 1.569g/cm3 | Boiling Point | 371.7ºC at 760 mmHg | |
| Molecular Formula | C15H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.6ºC | |
| Name | chembrdg-bb 5245899 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.569g/cm3 |
|---|---|
| Boiling Point | 371.7ºC at 760 mmHg |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.14900 |
| Flash Point | 178.6ºC |
| Exact Mass | 314.98900 |
| PSA | 42.24000 |
| LogP | 4.52060 |
| Index of Refraction | 1.709 |
| InChIKey | VGONJXTWHVKZHB-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2ccccc12)c1ccc(Br)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-bromo-n-1-naphthyl-2-furamide |