ethyl 5-hydroxy-2,4-dimethyl-1H-pyrrole-3-carboxylate
Modify Date: 2025-08-25 12:21:54
ethyl 5-hydroxy-2,4-dimethyl-1H-pyrrole-3-carboxylate structure
|
Common Name | ethyl 5-hydroxy-2,4-dimethyl-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 4030-28-8 | Molecular Weight | 183.20400 | |
| Density | 1.196g/cm3 | Boiling Point | 377.5ºC at 760 mmHg | |
| Molecular Formula | C9H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.1ºC | |
| Name | ethyl 5-hydroxy-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 377.5ºC at 760 mmHg |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.20400 |
| Flash Point | 182.1ºC |
| Exact Mass | 183.09000 |
| PSA | 62.32000 |
| LogP | 1.51380 |
| Vapour Pressure | 3.09E-06mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | JNQZBAQUMFAVOI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)[nH]c(O)c1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 5-hydroxy... CAS#:4030-28-8 |
| Literature: Metzger; Fischer Justus Liebigs Annalen der Chemie, 1937 , vol. 527, p. 1,14, 33 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Dimethyl-2-pyrrolin-5-on-3-carbonsaeure-ethylester |
| 2,4-Dimethyl-5-oxo-4,5-dihydro-pyrrol-3-carbonsaeure-aethylester |
| 2,4-dimethyl-5-oxo-4,5-dihydro-pyrrole-3-carboxylic acid ethyl ester |
| 2,4-Dimethyl-5-hydroxy-1H-pyrrol-3-carboxylic acid ethyl ester |