Acetamide, 2-(4-chlorophenoxy)-N-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | Acetamide, 2-(4-chlorophenoxy)-N-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 403-98-5 | Molecular Weight | 329.70200 | |
| Density | 1.394g/cm3 | Boiling Point | 461.4ºC at 760 mmHg | |
| Molecular Formula | C15H11ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8ºC | |
| Name | 2-(4-chlorophenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 461.4ºC at 760 mmHg |
| Molecular Formula | C15H11ClF3NO2 |
| Molecular Weight | 329.70200 |
| Flash Point | 232.8ºC |
| Exact Mass | 329.04300 |
| PSA | 38.33000 |
| LogP | 4.44930 |
| Vapour Pressure | 1.08E-08mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | GFSAUJZRPAFBGC-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1cccc(C(F)(F)F)c1 |
|
~%
Acetamide, 2-(4... CAS#:403-98-5 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |