HL-Tyr(2,6-Cl2-Bzl)-OH structure
|
Common Name | HL-Tyr(2,6-Cl2-Bzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 40298-69-9 | Molecular Weight | 340.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2s)-2-amino-3-(4-[(2,6-dichlorophenyl)methoxy]phenyl)propanoic acid |
|---|
| Molecular Formula | C16H15Cl2NO3 |
|---|---|
| Molecular Weight | 340.20100 |
| Exact Mass | 339.04300 |
| PSA | 72.55000 |
| LogP | 4.22710 |
| InChIKey | FTZFICPDLOOUKO-HNNXBMFYSA-N |
| SMILES | NC(Cc1ccc(OCc2c(Cl)cccc2Cl)cc1)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |