ethyl 2-(5-hydroxy-2,3-dihydro-1H-inden-2-yl)acetate
Modify Date: 2025-08-25 11:43:04
ethyl 2-(5-hydroxy-2,3-dihydro-1H-inden-2-yl)acetate structure
|
Common Name | ethyl 2-(5-hydroxy-2,3-dihydro-1H-inden-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 402933-35-1 | Molecular Weight | 220.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(5-hydroxy-2,3-dihydro-1H-inden-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26400 |
| Exact Mass | 220.11000 |
| PSA | 46.53000 |
| LogP | 2.06020 |
| InChIKey | NXAHYDZYTLMBQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1Cc2ccc(O)cc2C1 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1H-Indene-2-acetic acid,2,3-dihydro-5-hydroxy-,ethyl ester |