ethyl 2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetate
Modify Date: 2025-08-22 08:31:00
ethyl 2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetate structure
|
Common Name | ethyl 2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 402933-34-0 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 35.53000 |
| LogP | 2.36320 |
| InChIKey | IHAWUOQWFRVIKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1Cc2ccc(OC)cc2C1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1H-Indene-2-acetic acid,2,3-dihydro-5-methoxy-,ethyl ester |