[3-acetyloxy-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate structure
|
Common Name | [3-acetyloxy-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 4029-69-0 | Molecular Weight | 486.59700 | |
| Density | 1.24g/cm3 | Boiling Point | 596.6ºC at 760 mmHg | |
| Molecular Formula | C28H38O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
Use of [3-acetyloxy-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate3-O-Acetylbufotalin is a derivate of bufadienolide, with anti-cancer activity[1]. |
| Name | Bufotalin 3-acetate |
|---|---|
| Synonym | More Synonyms |
| Description | 3-O-Acetylbufotalin is a derivate of bufadienolide, with anti-cancer activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 3-O-Acetylbufotalin (2b) inhibits the growth of six human cancer cell lines, with a mean IC50 of 159 nM[1]. |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 596.6ºC at 760 mmHg |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.59700 |
| Flash Point | 191.9ºC |
| Exact Mass | 486.26200 |
| PSA | 103.04000 |
| LogP | 4.35430 |
| Vapour Pressure | 1.02E-16mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | NHHVQEFHQTULER-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C(c4ccc(=O)oc4)C(OC(C)=O)CC32O)C1 |
| digitoxigenin3-rhamnoside |
| evomonosid |
| a-hydroxy |
| 3-O-acetylbufotalin |
| digitoxigenin rhamnoside |
| DIGITOXIGENIN-3-O-A-L-RHAMNOPYRANOSIDE |
| DIGITOXIGENIN-3-O-RHAMNOSIDE |
| Digitoxigenine-3-rhamnoside |